CAS 191789-89-6 is the registry number for 1-(1-Acetyl-2,3-dihydro-1h-indol-5-yl)-2-chloropropan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(1-acetyl-2,3-dihydroindol-5-yl)-2-chloropropan-1-one (CAS 191789-89-6) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: 1-(1-acetyl-2,3-dihydroindol-5-yl)-2-chloropropan-1-one. InChIKey: JSMBGMRSUWECSH-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | 1-(1-acetyl-2,3-dihydroindol-5-yl)-2-chloropropan-1-one |
| InChIKey | JSMBGMRSUWECSH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC2=C(C=C1)N(CC2)C(=O)C)Cl |
Computed by PubChem (NCBI)