CAS 898779-86-7 appears in our catalog under these names: 2–(3–Phenoxybenzoyl)pyridine, 2-(3-Phenoxybenzoyl)pyridine, 95%, 95%, 2-(3-Phenoxybenzoyl)pyridine, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg.
(3-phenoxyphenyl)-pyridin-2-ylmethanone (CAS 898779-86-7) is a chemical compound with the molecular formula C18H13NO2 and a molecular weight of 275.3 g/mol. IUPAC name: (3-phenoxyphenyl)-pyridin-2-ylmethanone. InChIKey: BDDMYASOHOHAMU-UHFFFAOYSA-N.
| Molecular formula | C18H13NO2 |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | (3-phenoxyphenyl)-pyridin-2-ylmethanone |
| InChIKey | BDDMYASOHOHAMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C(=O)C3=CC=CC=N3 |
Computed by PubChem (NCBI)