CAS 1023496-33-4 is the registry number for 2-(indolinylmethylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-(2,3-dihydroindol-1-ylmethylidene)indene-1,3-dione (CAS 1023496-33-4) is a chemical compound with the molecular formula C18H13NO2 and a molecular weight of 275.3 g/mol. IUPAC name: 2-(2,3-dihydroindol-1-ylmethylidene)indene-1,3-dione. InChIKey: HYZVZBXZUAODLR-UHFFFAOYSA-N.
| Molecular formula | C18H13NO2 |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | 2-(2,3-dihydroindol-1-ylmethylidene)indene-1,3-dione |
| InChIKey | HYZVZBXZUAODLR-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C=C3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)