Products 181423-88-1
CAS 181423-88-1 is the registry number for Picosulfate Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(4-hydroxyphenyl)-pyridin-2-ylmethylidene]cyclohexa-2,5-dien-1-one (CAS 181423-88-1) is a chemical compound with the molecular formula C18H13NO2 and a molecular weight of 275.3 g/mol. IUPAC name: 4-[(4-hydroxyphenyl)-pyridin-2-ylmethylidene]cyclohexa-2,5-dien-1-one. InChIKey: BHKDKBTYBXYUND-UHFFFAOYSA-N.
| Molecular formula | C18H13NO2 |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | 4-[(4-hydroxyphenyl)-pyridin-2-ylmethylidene]cyclohexa-2,5-dien-1-one |
| InChIKey | BHKDKBTYBXYUND-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=C2C=CC(=O)C=C2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)