Products 60722-02-3
CAS 60722-02-3 appears in our catalog under these names: 11-Cyano-9,10-dihydro-9,10-ethanoanthracene-11-carboxylic acid, 98%, 98%, 11-Cyano-9,10-dihydro-9,10-ethanoanthracene-11-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
15-cyanotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid (CAS 60722-02-3) is a chemical compound with the molecular formula C18H13NO2 and a molecular weight of 275.3 g/mol. IUPAC name: 15-cyanotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid. InChIKey: KRSRIVVMHYJUFO-UHFFFAOYSA-N.
| Molecular formula | C18H13NO2 |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | 15-cyanotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid |
| InChIKey | KRSRIVVMHYJUFO-UHFFFAOYSA-N |
| SMILES | C1C2C3=CC=CC=C3C(C1(C#N)C(=O)O)C4=CC=CC=C24 |
Computed by PubChem (NCBI)