CAS 1393711-96-0 appears in our catalog under these names: 4–(4–Pyridin–4–ylphenyl)benzoic acid, 4'-(Pyridin-4-yl)-[1,1'-biphenyl]-4-carboxylic acid 98%, 4'-(Pyridin-4-yl)-[1,1'-biphenyl]-4-carboxylic acid, 98%, 98%, 4-(4-Pyridin-4-ylphenyl)benzoic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 500mg, 250mg, 5g.
4-(4-pyridin-4-ylphenyl)benzoic acid (CAS 1393711-96-0) is a chemical compound with the molecular formula C18H13NO2 and a molecular weight of 275.3 g/mol. IUPAC name: 4-(4-pyridin-4-ylphenyl)benzoic acid. InChIKey: GLBNFSQIBPLMFR-UHFFFAOYSA-N.
| Molecular formula | C18H13NO2 |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | 4-(4-pyridin-4-ylphenyl)benzoic acid |
| InChIKey | GLBNFSQIBPLMFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C(=O)O)C3=CC=NC=C3 |
Computed by PubChem (NCBI)