Products 38947-57-8

CAS 38947-57-8 appears in our catalog under these names: 2,6-Diphenylisonicotinic acid, 98%, 2,6-Diphenylisonicotinic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.

Structural formula: {0} (CAS {1})

2,6-diphenylpyridine-4-carboxylic acid (CAS 38947-57-8) is a chemical compound with the molecular formula C18H13NO2 and a molecular weight of 275.3 g/mol. IUPAC name: 2,6-diphenylpyridine-4-carboxylic acid. InChIKey: PWKUURSWFJBXGO-UHFFFAOYSA-N.

Identity
Molecular formulaC18H13NO2
Molecular weight275.3 g/mol
IUPAC name2,6-diphenylpyridine-4-carboxylic acid
InChIKeyPWKUURSWFJBXGO-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC(=CC(=N2)C3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)