CAS 2732762-06-8 is the registry number for 6-Hydroxy-N-acetyl-1-aminopyrenes (OHNAAP)-d8. Offered by: TRC. Available pack sizes: 5mg.
N-(2,3,4,5,7,8,9,10-octadeuterio-6-hydroxypyren-1-yl)acetamide (CAS 2732762-06-8) is a chemical compound with the molecular formula C18H13NO2 and a molecular weight of 283.3 g/mol. IUPAC name: N-(2,3,4,5,7,8,9,10-octadeuterio-6-hydroxypyren-1-yl)acetamide. InChIKey: VCLWCBGOALUALI-NHNJRVLXSA-N.
| Molecular formula | C18H13NO2 |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | N-(2,3,4,5,7,8,9,10-octadeuterio-6-hydroxypyren-1-yl)acetamide |
| InChIKey | VCLWCBGOALUALI-NHNJRVLXSA-N |
| SMILES | [2H]C1=C(C2=C(C(=C(C3=C2C4=C1C(=C(C(=C4C(=C3[2H])[2H])O)[2H])[2H])[2H])[2H])NC(=O)C)[2H] |
Computed by PubChem (NCBI)