Products 110113-96-7

CAS 110113-96-7 appears in our catalog under these names: 4-(2-(Quinolin-2-yl)vinyl)benzoic acid 95%, 4-[(E)-2-(quinolin-2-yl)ethenyl]benzoic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[(E)-2-quinolin-2-ylethenyl]benzoic acid (CAS 110113-96-7) is a chemical compound with the molecular formula C18H13NO2 and a molecular weight of 275.3 g/mol. IUPAC name: 4-[(E)-2-quinolin-2-ylethenyl]benzoic acid. InChIKey: BYCHJWRZXPXCKH-YRNVUSSQSA-N.

Identity
Molecular formulaC18H13NO2
Molecular weight275.3 g/mol
IUPAC name4-[(E)-2-quinolin-2-ylethenyl]benzoic acid
InChIKeyBYCHJWRZXPXCKH-YRNVUSSQSA-N
SMILESC1=CC=C2C(=C1)C=CC(=N2)/C=C/C3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)