cas: 21470-37-1 — see every product listed under this CAS number, including other names
2-(4-Biphenylyl)indole, >98.0%(GC) (CAS 21470-37-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B5250-1G |
| cas | 21470-37-1 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 403.55 Pln | |
| TCI | 5g | 1244.40 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2-(4-phenylphenyl)-1H-indole (CAS 21470-37-1) is a chemical compound with the molecular formula C20H15N and a molecular weight of 269.3 g/mol. IUPAC name: 2-(4-phenylphenyl)-1H-indole. InChIKey: IZQXDFSSLHWRBK-UHFFFAOYSA-N.
| Molecular formula | C20H15N |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 2-(4-phenylphenyl)-1H-indole |
| InChIKey | IZQXDFSSLHWRBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)