CAS 7099-88-9 appears in our catalog under these names: 4–Chlorobenzoylformic acid, 2-(4-Chlorophenyl)-2-oxoacetic acid, 98%, 98%, 4-Chlorobenzoylformic acid, 98%, 2-(4-Chlorophenyl)-2-oxoacetic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
2-(4-chlorophenyl)-2-oxoacetic acid (CAS 7099-88-9) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-oxoacetic acid. InChIKey: RSAXVDMWQCQTDT-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-oxoacetic acid |
| InChIKey | RSAXVDMWQCQTDT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(=O)O)Cl |
Computed by PubChem (NCBI)