Products 4657-56-1
CAS 4657-56-1 appears in our catalog under these names: 4-Chloro-2-formylbenzoic acid, 95%, 4-chloro-2-formyl-benzoic acid, 4-Chloro-2-formylbenzoic Acid, 4–Chloro–2–formylbenzoic acid, 4-Chloro-2-formylbenzoic acid 95%. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 100mg, on request, 5g.
4-chloro-2-formylbenzoic acid (CAS 4657-56-1) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 4-chloro-2-formylbenzoic acid. InChIKey: UAEFASLCDWQSDH-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 4-chloro-2-formylbenzoic acid |
| InChIKey | UAEFASLCDWQSDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C=O)C(=O)O |
Computed by PubChem (NCBI)