CAS 66411-55-0 appears in our catalog under these names: 1,3-Benzodioxole-4-carbonyl chloride, 98%, Benzo[d][1,3]dioxole-4-carbonyl chloride 95%, 1,3-Benzodioxole-4-carbonyl chloride, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg.
1,3-benzodioxole-4-carbonyl chloride (CAS 66411-55-0) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 1,3-benzodioxole-4-carbonyl chloride. InChIKey: LVBLTFSJUMJXBI-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 1,3-benzodioxole-4-carbonyl chloride |
| InChIKey | LVBLTFSJUMJXBI-UHFFFAOYSA-N |
| SMILES | C1OC2=CC=CC(=C2O1)C(=O)Cl |
Computed by PubChem (NCBI)