CAS 25054-53-9 appears in our catalog under these names: 1,3-Benzodioxole-5-carbonyl Chloride, >95% (HPLC), Piperonyloyl chloride, Piperonylic chloride, Piperonyloyl chloride, 98%, Piperonyloyl chloride 98%. Offered by: TRC, GLPBio, Biosynth, Thermo Scientific (Acros), Ambeed. Available pack sizes: 250mg, 25mg, 50mg, 10g, 1g, 5g, 2g, 25g.
1,3-benzodioxole-5-carbonyl chloride (CAS 25054-53-9) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 1,3-benzodioxole-5-carbonyl chloride. InChIKey: ZRSGZIMDIHBXIN-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 1,3-benzodioxole-5-carbonyl chloride |
| InChIKey | ZRSGZIMDIHBXIN-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)