Products 1289063-25-7
CAS 1289063-25-7 appears in our catalog under these names: 2-Chloro-4-formylbenzoic acid, 98%, 2–Chloro–4–formylbenzoic acid, 2-chloro-4-formylbenzoic acid, 2-Chloro-4-formylbenzoic acid 97%, 2-Chloro-4-formylbenzoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 1g, 100mg, 2,5g, 250mg.
2-chloro-4-formylbenzoic acid (CAS 1289063-25-7) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 2-chloro-4-formylbenzoic acid. InChIKey: SDXPWBZAOHPYIS-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 2-chloro-4-formylbenzoic acid |
| InChIKey | SDXPWBZAOHPYIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)Cl)C(=O)O |
Computed by PubChem (NCBI)