CAS 153203-59-9 appears in our catalog under these names: 3-Chloro-5-formylbenzoic acid, 95%, 3-Chloro-5-formylbenzoic Acid, 98+%, 3–Chloro–5–formylbenzoic Acid, 3-chloro-5-formylbenzoic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 0,25g, 0,1g, 0,5g.
3-chloro-5-formylbenzoic acid (CAS 153203-59-9) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 3-chloro-5-formylbenzoic acid. InChIKey: LWVHCYUHVMWJLJ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 3-chloro-5-formylbenzoic acid |
| InChIKey | LWVHCYUHVMWJLJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)Cl)C=O |
Computed by PubChem (NCBI)