CAS 18708-46-8 appears in our catalog under these names: 4-(chlorocarbonyl)Benzoic Acid, 4-(Chlorocarbonyl)benzoic acid 97%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
4-carbonochloridoylbenzoic acid (CAS 18708-46-8) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 4-carbonochloridoylbenzoic acid. InChIKey: OYEQKMASMPBQMP-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 4-carbonochloridoylbenzoic acid |
| InChIKey | OYEQKMASMPBQMP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)C(=O)Cl |
Computed by PubChem (NCBI)