Products 39561-82-5
CAS 39561-82-5 is the registry number for 2-(4-Chlorophenyl)-2-oxoethyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[2-(4-chlorophenyl)-2-oxoethyl] acetate (CAS 39561-82-5) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: [2-(4-chlorophenyl)-2-oxoethyl] acetate. InChIKey: FTUYTARZCNUSDA-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | [2-(4-chlorophenyl)-2-oxoethyl] acetate |
| InChIKey | FTUYTARZCNUSDA-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(4-Chlorophenyl)-2-oxoethyl acetate, [2-(4-chlorophenyl)-2-oxoethyl] acetate, 2-Acetoxy-4'-chloroacetophenone, 2-(4-Chlorophenyl)-2-oxoethylacetate, 4-chlorophenacyl acetate, 2-(4-Chlorophenyl)-2-oxoethyl acetate #, acetic acid 2-(4-chlorophenyl)-2-oxo-ethyl ester, 2-Acetoxy-4 inverted exclamation mark -chloroacetophenone