2-(4-Cyanophenoxy)propanoic acid, 98%
cas: 118618-36-3 — see every product listed under this CAS number, including other names
2-(4-Cyanophenoxy)propanoic acid, 98% (CAS 118618-36-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F718287-100MG |
| cas | 118618-36-3 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 424.87 Pln | |
| Fluorochem | 250mg | 669.57 Pln | |
| Fluorochem | 1g | 1653.60 Pln | |
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 403.75 Pln | |
| Ambeed | 1g | 993.38 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 462.80 Pln | |
| Chemat | 1g | 1144.40 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 430.98 Pln | |
| BLDpharm | 1g | 1069.65 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-(4-cyanophenoxy)propanoic acid (CAS 118618-36-3) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 2-(4-cyanophenoxy)propanoic acid. InChIKey: KXNITAHHTSHYPY-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 2-(4-cyanophenoxy)propanoic acid |
| InChIKey | KXNITAHHTSHYPY-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=CC=C(C=C1)C#N |
Computed by PubChem (NCBI)