Products 118618-36-3
CAS 118618-36-3 appears in our catalog under these names: 2-(4-Cyanophenoxy)propanoic acid, 95%, 2-(4-Cyanophenoxy)propanoic acid, 2-(4-Cyanophenoxy)propanoic acid 98%, 2-(4-Cyanophenoxy)propanoic acid, 98%, 98%, 2-(4-Cyanophenoxy)propanoic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 2g.
2-(4-cyanophenoxy)propanoic acid (CAS 118618-36-3) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 2-(4-cyanophenoxy)propanoic acid. InChIKey: KXNITAHHTSHYPY-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 2-(4-cyanophenoxy)propanoic acid |
| InChIKey | KXNITAHHTSHYPY-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=CC=C(C=C1)C#N |
Computed by PubChem (NCBI)