CAS 144060-99-1 appears in our catalog under these names: 2-(4-Fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%, 2–(4–Fluorophenyl)–4–methylthiazole–5–carboxylic acid, 2-(4-Fluorophenyl)-4-methyl-5-thiazolecarboxylic acid, 96%, 96%, 2-(4-Fluorophenyl)-4-methylthiazole-5-carboxylic acid, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g.
2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 144060-99-1) is a chemical compound with the molecular formula C11H8FNO2S and a molecular weight of 237.25 g/mol. IUPAC name: 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: LPBSLIRPWIFCQT-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2S |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | LPBSLIRPWIFCQT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)