Products 879070-41-4

CAS 879070-41-4 is the registry number for [2-(2-Fluorophenyl)-1,3-thiazol-4-yl]acetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]acetic acid (CAS 879070-41-4) is a chemical compound with the molecular formula C11H8FNO2S and a molecular weight of 237.25 g/mol. IUPAC name: 2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]acetic acid. InChIKey: PWDGGEJDPBDIAY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8FNO2S
Molecular weight237.25 g/mol
IUPAC name2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]acetic acid
InChIKeyPWDGGEJDPBDIAY-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=NC(=CS2)CC(=O)O)F

Computed by PubChem (NCBI)