Products 1027513-59-2
CAS 1027513-59-2 appears in our catalog under these names: 2-(3-Fluorophenyl)-4-methylthiazole-5-carboxylic acid, 2-(3-Fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid, 96%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g, 10g.
2-(3-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1027513-59-2) is a chemical compound with the molecular formula C11H8FNO2S and a molecular weight of 237.25 g/mol. IUPAC name: 2-(3-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: HBTVWEQIDYVHMD-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2S |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | HBTVWEQIDYVHMD-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=CC=C2)F)C(=O)O |
Computed by PubChem (NCBI)