CAS 433283-22-8 appears in our catalog under these names: 5-(4-Fluorophenyl)-2-methylthiazole-4-carboxylic acid, 95%, 5-(4-Fluorophenyl)-2-methylthiazole-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
5-(4-fluorophenyl)-2-methyl-1,3-thiazole-4-carboxylic acid (CAS 433283-22-8) is a chemical compound with the molecular formula C11H8FNO2S and a molecular weight of 237.25 g/mol. IUPAC name: 5-(4-fluorophenyl)-2-methyl-1,3-thiazole-4-carboxylic acid. InChIKey: XYIAPLYZWWLUBC-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2S |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-2-methyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | XYIAPLYZWWLUBC-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)