CAS 1360438-15-8 is the registry number for Methyl 2-(3-fluorophenyl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(3-fluorophenyl)-1,3-thiazole-4-carboxylate (CAS 1360438-15-8) is a chemical compound with the molecular formula C11H8FNO2S and a molecular weight of 237.25 g/mol. IUPAC name: methyl 2-(3-fluorophenyl)-1,3-thiazole-4-carboxylate. InChIKey: RTQZTVSJDAXVPF-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2S |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | methyl 2-(3-fluorophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | RTQZTVSJDAXVPF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)