CAS 1094230-04-2 appears in our catalog under these names: 2-((4-Fluorophenyl)methyl)-1,3-thiazole-5-carboxylic acid, 2-((4-Fluorophenyl)methyl)-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 10g.
2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxylic acid (CAS 1094230-04-2) is a chemical compound with the molecular formula C11H8FNO2S and a molecular weight of 237.25 g/mol. IUPAC name: 2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxylic acid. InChIKey: CRJSAVSSWSJYLR-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2S |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxylic acid |
| InChIKey | CRJSAVSSWSJYLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NC=C(S2)C(=O)O)F |
Computed by PubChem (NCBI)