CAS 1314419-46-9 is the registry number for Methyl 2-(4-fluorophenyl)thiazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate (CAS 1314419-46-9) is a chemical compound with the molecular formula C11H8FNO2S and a molecular weight of 237.25 g/mol. IUPAC name: methyl 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate. InChIKey: FSVPWBHNWNRJRL-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2S |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | methyl 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | FSVPWBHNWNRJRL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)