CAS 17969-24-3 is the registry number for [2-(4-Fluorophenyl)-1,3-thiazol-4-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetic acid (CAS 17969-24-3) is a chemical compound with the molecular formula C11H8FNO2S and a molecular weight of 237.25 g/mol. IUPAC name: 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetic acid. InChIKey: QOJQFOYPWWTPCA-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2S |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | QOJQFOYPWWTPCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)CC(=O)O)F |
Computed by PubChem (NCBI)