cas: 2403-53-4 — see every product listed under this CAS number, including other names
2-(4-NITROPHENYL)-1,3-DIOXOLANE, 97% (CAS 2403-53-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F474795-1G |
| cas | 2403-53-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 10g | 404.04 Pln | |
| Fluorochem | 25g | 888.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-nitrophenyl)-1,3-dioxolane (CAS 2403-53-4) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-(4-nitrophenyl)-1,3-dioxolane. InChIKey: RIXYVXYKLYQCSM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-1,3-dioxolane |
| InChIKey | RIXYVXYKLYQCSM-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)