Products 2403-53-4
CAS 2403-53-4 appears in our catalog under these names: 2-(4-Nitrophenyl)-1,3-dioxolane, 2-(4-Nitrophenyl)-1,3-dioxolane, 98%, 2-(4-Nitrophenyl)-1,3-dioxolane 98%, 2-(4-NITROPHENYL)-1,3-DIOXOLANE, 97%, 2-(4-Nitrophenyl)-1,3-dioxolane, >98.0%(GC). Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem, TCI. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-(4-nitrophenyl)-1,3-dioxolane (CAS 2403-53-4) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-(4-nitrophenyl)-1,3-dioxolane. InChIKey: RIXYVXYKLYQCSM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-1,3-dioxolane |
| InChIKey | RIXYVXYKLYQCSM-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2-(4-Nitrophenyl)-1,3-dioxolane, 2-(p-Nitrophenyl)-1,3-dioxolane, p-Nitrobenzaldehyde ethylene acetal, 1,3-Dioxolane, 2-(p-nitrophenyl)-, 1,3-Dioxolane, 2-(4-nitrophenyl)-, 1, 2-(p-nitrophenyl)-, 1,3-Dioxolane,2-(4-nitrophenyl)-, NCIOpen2_002237, 4-nitrophenyl-1,3-dioxolane, 2-(4-nitrophenyl)-[1,3]dioxolane