cas: 2403-53-4 — see every product listed under this CAS number, including other names
2-(4-Nitrophenyl)-1,3-dioxolane, >98.0%(GC) (CAS 2403-53-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N1228-5G |
| cas | 2403-53-4 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 246.19 Pln | |
| TCI | 25g | 806.76 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2-(4-nitrophenyl)-1,3-dioxolane (CAS 2403-53-4) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-(4-nitrophenyl)-1,3-dioxolane. InChIKey: RIXYVXYKLYQCSM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-1,3-dioxolane |
| InChIKey | RIXYVXYKLYQCSM-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)