2-(Carboxymethoxy)benzoic acid, 97%, 97%
cas: 635-53-0 — see every product listed under this CAS number, including other names
2-(Carboxymethoxy)benzoic acid, 97%, 97% (CAS 635-53-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114F16-250mg |
| cas | 635-53-0 |
| size | 250mg |
| availability | 20g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 500mg | 222.80 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 755.60 Pln | |
| Chemat | 10g | 1307.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(carboxymethoxy)benzoic acid (CAS 635-53-0) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 2-(carboxymethoxy)benzoic acid. InChIKey: JLLXSRLEXBECPY-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 2-(carboxymethoxy)benzoic acid |
| InChIKey | JLLXSRLEXBECPY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(Carboxymethoxy)benzoic acid, Benzoic acid, 2-(carboxymethoxy)-, (o-Carboxyphenoxy)acetic acid, o-(Carboxymethoxy)benzoic acid, Acetic acid, (o-carboxyphenoxy)-, Acetic acid, (2-carboxyphenoxy)-, o-Anisic acid, alpha-carboxy-, 4-10-00-00140 (Beilstein Handbook Reference), o-Anisic acid, alpha-carboxy-(8CI), Salicylacetic acid