CAS 59393-79-2 is the registry number for 2-(Cyanomethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(cyanomethoxy)benzoic acid (CAS 59393-79-2) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 2-(cyanomethoxy)benzoic acid. InChIKey: BGCVCJBIFBISFN-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 2-(cyanomethoxy)benzoic acid |
| InChIKey | BGCVCJBIFBISFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OCC#N |
Computed by PubChem (NCBI)