CAS 90322-37-5 appears in our catalog under these names: 2-Oxoindoline-4-carboxylic acid, 95%, 2–Oxoindoline–4–carboxylic acid, 2-Oxoindoline-4-carboxylic acid, 96%, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 25g.
2-oxo-1,3-dihydroindole-4-carboxylic acid (CAS 90322-37-5) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 2-oxo-1,3-dihydroindole-4-carboxylic acid. InChIKey: ALXJUSWINGKGAW-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 2-oxo-1,3-dihydroindole-4-carboxylic acid |
| InChIKey | ALXJUSWINGKGAW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2NC1=O)C(=O)O |
Computed by PubChem (NCBI)