cas: 24195-07-1 — see every product listed under this CAS number, including other names
2-(Methoxycarbonyl)nicotinic acid, 96%, 96% (CAS 24195-07-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BD8R-100mg |
| cas | 24195-07-1 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 482.00 Pln | |
| Chemat | 25g | 2075.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-methoxycarbonylpyridine-3-carboxylic acid (CAS 24195-07-1) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 2-methoxycarbonylpyridine-3-carboxylic acid. InChIKey: OSSIORZYXTUXBL-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 2-methoxycarbonylpyridine-3-carboxylic acid |
| InChIKey | OSSIORZYXTUXBL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=N1)C(=O)O |
Computed by PubChem (NCBI)