cas: 24195-07-1 — see every product listed under this CAS number, including other names
2-(Methoxycarbonyl)nicotinic acid, 97% (CAS 24195-07-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F066879-250MG |
| cas | 24195-07-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 674.78 Pln | |
| Fluorochem | 10g | 1294.35 Pln | |
| Fluorochem | 25g | 3153.07 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-methoxycarbonylpyridine-3-carboxylic acid (CAS 24195-07-1) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 2-methoxycarbonylpyridine-3-carboxylic acid. InChIKey: OSSIORZYXTUXBL-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 2-methoxycarbonylpyridine-3-carboxylic acid |
| InChIKey | OSSIORZYXTUXBL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=N1)C(=O)O |
Computed by PubChem (NCBI)