cas: 743440-23-5 — see every product listed under this CAS number, including other names
2-{8-oxatricyclo(7.4.0.0,2,7)trideca-1(9),2(7),3,5,10,12-hexaen-4-yloxy}acetic acid, 95% (CAS 743440-23-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1010585-10g |
| cas | 743440-23-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17842.30 Pln | |
| AmBeed | 5g | 11495.05 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-dibenzofuran-2-yloxyacetic acid (CAS 743440-23-5) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 2-dibenzofuran-2-yloxyacetic acid. InChIKey: KLJPFPXXIRGPLF-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 2-dibenzofuran-2-yloxyacetic acid |
| InChIKey | KLJPFPXXIRGPLF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)OCC(=O)O |
Computed by PubChem (NCBI)