cas: 1503-53-3 — see every product listed under this CAS number, including other names
2-Acetoxy-5-bromobenzoic acid, 95% (CAS 1503-53-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F722440-100MG |
| cas | 1503-53-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 518.59 Pln | |
| Fluorochem | 1g | 1008.00 Pln | |
| Fluorochem | 5g | 2908.37 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-acetyloxy-5-bromobenzoic acid (CAS 1503-53-3) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 2-acetyloxy-5-bromobenzoic acid. InChIKey: VRJBEVQGJOSGOX-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 2-acetyloxy-5-bromobenzoic acid |
| InChIKey | VRJBEVQGJOSGOX-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)