CAS 911799-84-3 appears in our catalog under these names: 2-Bromo-4-(methoxycarbonyl)benzoic acid, 97%, 2–Bromo–4–(methoxycarbonyl)benzoic acid, 2-Bromo-4-(methoxycarbonyl)benzoic acid, 95%, 95%, 2-Bromo-4-(methoxycarbonyl)benzoic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
2-bromo-4-methoxycarbonylbenzoic acid (CAS 911799-84-3) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 2-bromo-4-methoxycarbonylbenzoic acid. InChIKey: NVIVSQBLUICPCL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 2-bromo-4-methoxycarbonylbenzoic acid |
| InChIKey | NVIVSQBLUICPCL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)O)Br |
Computed by PubChem (NCBI)