CAS 1503-53-3 appears in our catalog under these names: 2-(Acetyloxy)-5-bromobenzoic acid, 95%, 2–Acetoxy–5–bromobenzoic acid, 2-Acetoxy-5-bromobenzoic acid, 95%, 95%, 2-Acetoxy-5-bromobenzoic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-acetyloxy-5-bromobenzoic acid (CAS 1503-53-3) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 2-acetyloxy-5-bromobenzoic acid. InChIKey: VRJBEVQGJOSGOX-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 2-acetyloxy-5-bromobenzoic acid |
| InChIKey | VRJBEVQGJOSGOX-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)