CAS 5470-14-4 appears in our catalog under these names: (6-Bromo-1,3-benzodioxol-5-yl)acetic acid, 95%, 2-(6-Bromobenzo(d)(1,3)dioxol-5-yl)acetic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-(6-bromo-1,3-benzodioxol-5-yl)acetic acid (CAS 5470-14-4) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 2-(6-bromo-1,3-benzodioxol-5-yl)acetic acid. InChIKey: OEKSRUJGTGXBMM-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 2-(6-bromo-1,3-benzodioxol-5-yl)acetic acid |
| InChIKey | OEKSRUJGTGXBMM-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CC(=O)O)Br |
Computed by PubChem (NCBI)