CAS 19725-82-7 appears in our catalog under these names: 5-Bromo-2-(carboxymethyl)benzoic acid, 98%, 5–Bromo–2–(carboxymethyl)benzoic acid, 5-Bromo-2-(carboxymethyl)benzoic acid, 5-Bromo-2-(carboxymethyl)benzoic acid 97%, 5-Bromo-2-(carboxymethyl)benzoic Acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg, 2,5g.
5-bromo-2-(carboxymethyl)benzoic acid (CAS 19725-82-7) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 5-bromo-2-(carboxymethyl)benzoic acid. InChIKey: VFYONOBJKYTLNC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 5-bromo-2-(carboxymethyl)benzoic acid |
| InChIKey | VFYONOBJKYTLNC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)O)CC(=O)O |
Computed by PubChem (NCBI)