CAS 61441-09-6 appears in our catalog under these names: Methyl 6-bromobenzo[d][1,3]dioxole-5-carboxylate, 95%, methyl 6–bromobenzo(d)(1,3)dioxole–5–carboxylate, methyl 6-bromobenzo[d][1,3]dioxole-5-carboxylate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
Methyl 6-bromo-1,3-benzodioxole-5-carboxylate (CAS 61441-09-6) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: methyl 6-bromo-1,3-benzodioxole-5-carboxylate. InChIKey: OOWBNMSDTXJYGE-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | methyl 6-bromo-1,3-benzodioxole-5-carboxylate |
| InChIKey | OOWBNMSDTXJYGE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1Br)OCO2 |
Computed by PubChem (NCBI)