CAS 212897-62-6 appears in our catalog under these names: Methyl 5-bromobenzo[d][1,3]dioxole-4-carboxylate, 95%, Methyl 5-bromobenzo[d][1,3]dioxole-4-carboxylate, ≥95%, ≥95%, Methyl 5-bromobenzo[d][1,3]dioxole-4-carboxylate, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Methyl 5-bromo-1,3-benzodioxole-4-carboxylate (CAS 212897-62-6) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: methyl 5-bromo-1,3-benzodioxole-4-carboxylate. InChIKey: ZKKRHLPBIKPKAL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | methyl 5-bromo-1,3-benzodioxole-4-carboxylate |
| InChIKey | ZKKRHLPBIKPKAL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC2=C1OCO2)Br |
Computed by PubChem (NCBI)