Products 943749-63-1
CAS 943749-63-1 appears in our catalog under these names: 4-Bromo-2-(carboxymethyl)benzoic acid, 95%, 4-bromo-2-(carboxymethyl)benzoic acid, 4-Bromo-2-(carboxymethyl)benzoic acid 95%, 4-Bromo-2-(carboxymethyl)benzoic acid, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 2,5g, 250mg, 100mg, 10g.
4-bromo-2-(carboxymethyl)benzoic acid (CAS 943749-63-1) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 4-bromo-2-(carboxymethyl)benzoic acid. InChIKey: WDKVNGVXRHWUEQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 4-bromo-2-(carboxymethyl)benzoic acid |
| InChIKey | WDKVNGVXRHWUEQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)