2-Amino-4,5-dichlorobenzenesulfonic acid, 98%
cas: 6331-96-0 — see every product listed under this CAS number, including other names
2-Amino-4,5-dichlorobenzenesulfonic acid, 98% (CAS 6331-96-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F242000-25G |
| cas | 6331-96-0 |
| size | 25g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 247.85 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 25g | 174.80 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 153.30 Pln | |
| BLDpharm | 25g | 269.93 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
2-amino-4,5-dichlorobenzenesulfonic acid (CAS 6331-96-0) is a chemical compound with the molecular formula C6H5Cl2NO3S and a molecular weight of 242.08 g/mol. IUPAC name: 2-amino-4,5-dichlorobenzenesulfonic acid. InChIKey: AKLDPNVZTZIVFA-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO3S |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | 2-amino-4,5-dichlorobenzenesulfonic acid |
| InChIKey | AKLDPNVZTZIVFA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)S(=O)(=O)O)N |
Computed by PubChem (NCBI)