cas: 40230-24-8 — see every product listed under this CAS number, including other names
2-Amino-4,6-diphenylpyrimidine, >98.0%(GC)(T) (CAS 40230-24-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A2921-1G |
| cas | 40230-24-8 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 246.19 Pln | |
| TCI | 5g | 959.19 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
4,6-diphenylpyrimidin-2-amine (CAS 40230-24-8) is a chemical compound with the molecular formula C16H13N3 and a molecular weight of 247.29 g/mol. IUPAC name: 4,6-diphenylpyrimidin-2-amine. InChIKey: KZUCBEYDRUCBCS-UHFFFAOYSA-N.
| Molecular formula | C16H13N3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 4,6-diphenylpyrimidin-2-amine |
| InChIKey | KZUCBEYDRUCBCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=N2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)