cas: 40230-24-8 — see every product listed under this CAS number, including other names
4,6-Diphenylpyrimidin-2-amine, 97% (CAS 40230-24-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F334512-100MG |
| cas | 40230-24-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 685.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4,6-diphenylpyrimidin-2-amine (CAS 40230-24-8) is a chemical compound with the molecular formula C16H13N3 and a molecular weight of 247.29 g/mol. IUPAC name: 4,6-diphenylpyrimidin-2-amine. InChIKey: KZUCBEYDRUCBCS-UHFFFAOYSA-N.
| Molecular formula | C16H13N3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 4,6-diphenylpyrimidin-2-amine |
| InChIKey | KZUCBEYDRUCBCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=N2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)