cas: 40230-24-8 — see every product listed under this CAS number, including other names
4,6-Diphenylpyrimidin-2-amine, 97% (CAS 40230-24-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F334512-5G |
| cas | 40230-24-8 |
| size | 5g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 643.54 Pln | |
| Fluorochem | 10g | 1075.68 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 626.25 Pln | |
| Ambeed | 10g | 1043.44 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 414.80 Pln | |
| Chemat | 10g | 698.00 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4,6-diphenylpyrimidin-2-amine (CAS 40230-24-8) is a chemical compound with the molecular formula C16H13N3 and a molecular weight of 247.29 g/mol. IUPAC name: 4,6-diphenylpyrimidin-2-amine. InChIKey: KZUCBEYDRUCBCS-UHFFFAOYSA-N.
| Molecular formula | C16H13N3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 4,6-diphenylpyrimidin-2-amine |
| InChIKey | KZUCBEYDRUCBCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=N2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)