CAS 1206249-58-2 is the registry number for methyl 6-bromo-4-nitropicolinate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 6-bromo-4-nitropyridine-2-carboxylate (CAS 1206249-58-2) is a chemical compound with the molecular formula C7H5BrN2O4 and a molecular weight of 261.03 g/mol. IUPAC name: methyl 6-bromo-4-nitropyridine-2-carboxylate. InChIKey: BIGPTIJIVHMOAS-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O4 |
|---|---|
| Molecular weight | 261.03 g/mol |
| IUPAC name | methyl 6-bromo-4-nitropyridine-2-carboxylate |
| InChIKey | BIGPTIJIVHMOAS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=CC(=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)