CAS 3013-38-5 appears in our catalog under these names: 2,4-Dinitrobenzyl Bromide, >95% (HPLC), 2,4–Dinitrobenzylbromide, 1-(Bromomethyl)-2,4-dinitrobenzene, 2,4-DINITROBENZYL BROMIDE, 98%+(GC-MS),RG, 98%+(GC-MS),RG, 2,4-DINITROBENZYL BROMIDE, 98%+(GC-MS),RG. Offered by: TRC, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 500mg, 250mg, 0,5g, 5g.
1-(bromomethyl)-2,4-dinitrobenzene (CAS 3013-38-5) is a chemical compound with the molecular formula C7H5BrN2O4 and a molecular weight of 261.03 g/mol. IUPAC name: 1-(bromomethyl)-2,4-dinitrobenzene. InChIKey: ZDBJFAWRZSOCMM-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O4 |
|---|---|
| Molecular weight | 261.03 g/mol |
| IUPAC name | 1-(bromomethyl)-2,4-dinitrobenzene |
| InChIKey | ZDBJFAWRZSOCMM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)